C22H27NO3S — CID 11794503
(2R,5R,6R)-5-[(R)-(2-aminophenyl)sulfanyl-phenylmethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one (PubChem CID 11794503) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is (2R,5R,6R)-5-[(R)-(2-aminophenyl)sulfanyl-phenylmethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,5R,6R)-5-[(R)-(2-aminophenyl)sulfanyl-phenylmethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 11794503 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (2R,5R,6R)-5-[(R)-(2-aminophenyl)sulfanyl-phenylmethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
| SMILES | C[C@H]1O[C@@H](C(C)(C)C)OC(=O)[C@@H]1[C@@H](Sc1ccccc1N)c1ccccc1 |
| InChI | InChI=1S/C22H27NO3S/c1-14-18(20(24)26-21(25-14)22(2,3)4)19(15-10-6-5-7-11-15)27-17-13-9-8-12-16(17)23/h5-14,18-19,21H,23H2,1-4H3/t14-,18+,19+,21-/m1/s1 |
| InChIKey | YKUMLEXLIKYYJQ-XPKQXGJGSA-N |
| XLogP | 5.05 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|