C19H29NO3S — CID 10594106
(2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanyl-2-methylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one (PubChem CID 10594106) has the molecular formula C19H29NO3S and a molecular weight of 351.51 g/mol. Its IUPAC name is (2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanyl-2-methylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanyl-2-methylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 10594106 |
| Molecular Formula | C19H29NO3S |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | (2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanyl-2-methylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
| SMILES | CC(C)[C@H](Sc1ccccc1N)[C@H]1C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C19H29NO3S/c1-11(2)16(24-14-10-8-7-9-13(14)20)15-12(3)22-18(19(4,5)6)23-17(15)21/h7-12,15-16,18H,20H2,1-6H3/t12-,15+,16+,18-/m1/s1 |
| InChIKey | NCWWRABRHSDELD-BLBBIFAFSA-N |
| XLogP | 4.34 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|