C24H31NO3S — CID 10787901
(2R,5R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanyl-3-phenylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one (PubChem CID 10787901) has the molecular formula C24H31NO3S and a molecular weight of 413.58 g/mol. Its IUPAC name is (2R,5R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanyl-3-phenylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,5R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanyl-3-phenylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 10787901 |
| Molecular Formula | C24H31NO3S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (2R,5R,6R)-5-[(1R)-1-(2-aminophenyl)sulfanyl-3-phenylpropyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
| SMILES | C[C@H]1O[C@@H](C(C)(C)C)OC(=O)[C@@H]1[C@@H](CCc1ccccc1)Sc1ccccc1N |
| InChI | InChI=1S/C24H31NO3S/c1-16-21(22(26)28-23(27-16)24(2,3)4)20(15-14-17-10-6-5-7-11-17)29-19-13-9-8-12-18(19)25/h5-13,16,20-21,23H,14-15,25H2,1-4H3/t16-,20-,21+,23-/m1/s1 |
| InChIKey | SKKGDCHULWPFJO-BMWHPICZSA-N |
| XLogP | 5.31 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|