C17H25NO3S — CID 10615918
(2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanylethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one (PubChem CID 10615918) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanylethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one.
| Compound Name | (2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanylethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 10615918 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2R,5R,6R)-5-[(1S)-1-(2-aminophenyl)sulfanylethyl]-2-tert-butyl-6-methyl-1,3-dioxan-4-one |
| SMILES | C[C@H](Sc1ccccc1N)[C@H]1C(=O)O[C@H](C(C)(C)C)O[C@@H]1C |
| InChI | InChI=1S/C17H25NO3S/c1-10-14(15(19)21-16(20-10)17(3,4)5)11(2)22-13-9-7-6-8-12(13)18/h6-11,14,16H,18H2,1-5H3/t10-,11+,14+,16-/m1/s1 |
| InChIKey | HVIWTCSDYKSZHL-PSHZPRKYSA-N |
| XLogP | 3.70 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|