C16H16FNO2S — CID 106676882
ethyl 2-(2-amino-4-fluorophenyl)sulfanyl-2-phenylacetate (PubChem CID 106676882) has the molecular formula C16H16FNO2S and a molecular weight of 305.37 g/mol. Its IUPAC name is ethyl 2-(2-amino-4-fluorophenyl)sulfanyl-2-phenylacetate.
| Compound Name | ethyl 2-(2-amino-4-fluorophenyl)sulfanyl-2-phenylacetate |
|---|---|
| PubChem CID | 106676882 |
| Molecular Formula | C16H16FNO2S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | ethyl 2-(2-amino-4-fluorophenyl)sulfanyl-2-phenylacetate |
| SMILES | CCOC(=O)C(Sc1ccc(F)cc1N)c1ccccc1 |
| InChI | InChI=1S/C16H16FNO2S/c1-2-20-16(19)15(11-6-4-3-5-7-11)21-14-9-8-12(17)10-13(14)18/h3-10,15H,2,18H2,1H3 |
| InChIKey | ORCIEGBKNLHGLU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|