C14H17NO4S — CID 10685286
methyl 4-(2-aminophenyl)sulfanyl-5,5-dimethyl-2-oxooxolane-3-carboxylate (PubChem CID 10685286) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is methyl 4-(2-aminophenyl)sulfanyl-5,5-dimethyl-2-oxooxolane-3-carboxylate.
| Compound Name | methyl 4-(2-aminophenyl)sulfanyl-5,5-dimethyl-2-oxooxolane-3-carboxylate |
|---|---|
| PubChem CID | 10685286 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl 4-(2-aminophenyl)sulfanyl-5,5-dimethyl-2-oxooxolane-3-carboxylate |
| SMILES | COC(=O)C1C(=O)OC(C)(C)C1Sc1ccccc1N |
| InChI | InChI=1S/C14H17NO4S/c1-14(2)11(10(12(16)18-3)13(17)19-14)20-9-7-5-4-6-8(9)15/h4-7,10-11H,15H2,1-3H3 |
| InChIKey | DZONVMYNCLHHKI-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|