C12H14N2O7 — CID 107822565
(2S)-4-hydroxy-2-[[2-(4-nitrophenoxy)acetyl]amino]butanoic acid (PubChem CID 107822565) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[[2-(4-nitrophenoxy)acetyl]amino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[[2-(4-nitrophenoxy)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107822565 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (2S)-4-hydroxy-2-[[2-(4-nitrophenoxy)acetyl]amino]butanoic acid |
| SMILES | O=C(COc1ccc([N+](=O)[O-])cc1)N[C@@H](CCO)C(=O)O |
| InChI | InChI=1S/C12H14N2O7/c15-6-5-10(12(17)18)13-11(16)7-21-9-3-1-8(2-4-9)14(19)20/h1-4,10,15H,5-7H2,(H,13,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | AHMASIVSNATALF-JTQLQIEISA-N |
| XLogP | -0.07 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|