C12H13F2NO4 — CID 107822798
(2R)-2-[[2-(2,6-difluorophenyl)acetyl]amino]-4-hydroxybutanoic acid (PubChem CID 107822798) has the molecular formula C12H13F2NO4 and a molecular weight of 273.23 g/mol. Its IUPAC name is (2R)-2-[[2-(2,6-difluorophenyl)acetyl]amino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[[2-(2,6-difluorophenyl)acetyl]amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107822798 |
| Molecular Formula | C12H13F2NO4 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | (2R)-2-[[2-(2,6-difluorophenyl)acetyl]amino]-4-hydroxybutanoic acid |
| SMILES | O=C(Cc1c(F)cccc1F)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C12H13F2NO4/c13-8-2-1-3-9(14)7(8)6-11(17)15-10(4-5-16)12(18)19/h1-3,10,16H,4-6H2,(H,15,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | RXNJRIZBMZSIRB-SNVBAGLBSA-N |
| XLogP | 0.46 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |