C11H14N4O4 — CID 107824603
(2S)-4-amino-2-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-oxobutanoic acid (PubChem CID 107824603) has the molecular formula C11H14N4O4 and a molecular weight of 266.26 g/mol. Its IUPAC name is (2S)-4-amino-2-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-oxobutanoic acid.
| Compound Name | (2S)-4-amino-2-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107824603 |
| Molecular Formula | C11H14N4O4 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (2S)-4-amino-2-[[2-(5-amino-2-pyridinyl)acetyl]amino]-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@H](NC(=O)Cc1ccc(N)cn1)C(=O)O |
| InChI | InChI=1S/C11H14N4O4/c12-6-1-2-7(14-5-6)3-10(17)15-8(11(18)19)4-9(13)16/h1-2,5,8H,3-4,12H2,(H2,13,16)(H,15,17)(H,18,19)/t8-/m0/s1 |
| InChIKey | KUAVCJLVPCSARA-QMMMGPOBSA-N |
| XLogP | -1.35 |
| TPSA | 148.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |