C10H17N3O5 — CID 107827630
(2R)-4-amino-2-(1,4-oxazepane-4-carbonylamino)-4-oxobutanoic acid (PubChem CID 107827630) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is (2R)-4-amino-2-(1,4-oxazepane-4-carbonylamino)-4-oxobutanoic acid.
| Compound Name | (2R)-4-amino-2-(1,4-oxazepane-4-carbonylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107827630 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2R)-4-amino-2-(1,4-oxazepane-4-carbonylamino)-4-oxobutanoic acid |
| SMILES | NC(=O)C[C@@H](NC(=O)N1CCCOCC1)C(=O)O |
| InChI | InChI=1S/C10H17N3O5/c11-8(14)6-7(9(15)16)12-10(17)13-2-1-4-18-5-3-13/h7H,1-6H2,(H2,11,14)(H,12,17)(H,15,16)/t7-/m1/s1 |
| InChIKey | OKZKXZBVNDXQMK-SSDOTTSWSA-N |
| XLogP | -1.25 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |