C13H22N2O5 — CID 107828628
(2R)-5-methoxy-5-oxo-2-[[prop-2-enyl(propyl)carbamoyl]amino]pentanoic acid (PubChem CID 107828628) has the molecular formula C13H22N2O5 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2R)-5-methoxy-5-oxo-2-[[prop-2-enyl(propyl)carbamoyl]amino]pentanoic acid.
| Compound Name | (2R)-5-methoxy-5-oxo-2-[[prop-2-enyl(propyl)carbamoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107828628 |
| Molecular Formula | C13H22N2O5 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | (2R)-5-methoxy-5-oxo-2-[[prop-2-enyl(propyl)carbamoyl]amino]pentanoic acid |
| SMILES | C=CCN(CCC)C(=O)N[C@H](CCC(=O)OC)C(=O)O |
| InChI | InChI=1S/C13H22N2O5/c1-4-8-15(9-5-2)13(19)14-10(12(17)18)6-7-11(16)20-3/h4,10H,1,5-9H2,2-3H3,(H,14,19)(H,17,18)/t10-/m1/s1 |
| InChIKey | GSYAZJKOIYBTTH-SNVBAGLBSA-N |
| XLogP | 1.00 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|