C12H20N2O5 — CID 107828807
(2R)-4-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)amino]butanoic acid (PubChem CID 107828807) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is (2R)-4-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)amino]butanoic acid.
| Compound Name | (2R)-4-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107828807 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2R)-4-hydroxy-2-[(4-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)[C@@H](CCO)NC(=O)N1CC2CCC(O)C2C1 |
| InChI | InChI=1S/C12H20N2O5/c15-4-3-9(11(17)18)13-12(19)14-5-7-1-2-10(16)8(7)6-14/h7-10,15-16H,1-6H2,(H,13,19)(H,17,18)/t7?,8?,9-,10?/m1/s1 |
| InChIKey | OQGWWVSTRGUORT-OWTMBLHMSA-N |
| XLogP | -0.77 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |