C12H18N2O5 — CID 115560906
(2S)-2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonylamino)butanedioic acid (PubChem CID 115560906) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2S)-2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonylamino)butanedioic acid.
| Compound Name | (2S)-2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonylamino)butanedioic acid |
|---|---|
| PubChem CID | 115560906 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2S)-2-(3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carbonylamino)butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)N1CC2CCCC2C1)C(=O)O |
| InChI | InChI=1S/C12H18N2O5/c15-10(16)4-9(11(17)18)13-12(19)14-5-7-2-1-3-8(7)6-14/h7-9H,1-6H2,(H,13,19)(H,15,16)(H,17,18)/t7?,8?,9-/m0/s1 |
| InChIKey | RMLGYRKZRNDJTP-HACHORDNSA-N |
| XLogP | 0.36 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |