C7H13NO7S — CID 107835237
(2S)-2-hydroxy-3-[(3-methoxy-3-oxopropyl)sulfonylamino]propanoic acid (PubChem CID 107835237) has the molecular formula C7H13NO7S and a molecular weight of 255.25 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[(3-methoxy-3-oxopropyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[(3-methoxy-3-oxopropyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 107835237 |
| Molecular Formula | C7H13NO7S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | (2S)-2-hydroxy-3-[(3-methoxy-3-oxopropyl)sulfonylamino]propanoic acid |
| SMILES | COC(=O)CCS(=O)(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C7H13NO7S/c1-15-6(10)2-3-16(13,14)8-4-5(9)7(11)12/h5,8-9H,2-4H2,1H3,(H,11,12)/t5-/m0/s1 |
| InChIKey | VIKVUWXMMRDMCR-YFKPBYRVSA-N |
| XLogP | -2.09 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |