C17H30O5Si — CID 10783528
(3aS,6S,7aR)-3-ethyl-3-hydroxy-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione (PubChem CID 10783528) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is (3aS,6S,7aR)-3-ethyl-3-hydroxy-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione.
| Compound Name | (3aS,6S,7aR)-3-ethyl-3-hydroxy-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione |
|---|---|
| PubChem CID | 10783528 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (3aS,6S,7aR)-3-ethyl-3-hydroxy-6-methyl-6-triethylsilyloxy-3a,4,7,7a-tetrahydro-1-benzofuran-2,5-dione |
| SMILES | CCC1(O)C(=O)O[C@@H]2C[C@](C)(O[Si](CC)(CC)CC)C(=O)C[C@@H]21 |
| InChI | InChI=1S/C17H30O5Si/c1-6-17(20)12-10-14(18)16(5,11-13(12)21-15(17)19)22-23(7-2,8-3)9-4/h12-13,20H,6-11H2,1-5H3/t12-,13+,16-,17?/m0/s1 |
| InChIKey | KFUZLUWCTVIAQH-XLKCZGELSA-N |
| XLogP | 2.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|