C14H21NO5 — CID 107835367
4-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)-2-hydroxybutanoic acid (PubChem CID 107835367) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is 4-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)-2-hydroxybutanoic acid.
| Compound Name | 4-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107835367 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-(1,3-dioxo-2-azaspiro[4.6]undecan-2-yl)-2-hydroxybutanoic acid |
| SMILES | O=C(O)C(O)CCN1C(=O)CC2(CCCCCC2)C1=O |
| InChI | InChI=1S/C14H21NO5/c16-10(12(18)19)5-8-15-11(17)9-14(13(15)20)6-3-1-2-4-7-14/h10,16H,1-9H2,(H,18,19) |
| InChIKey | SMDVIDQXJAPTCH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|