C12H18N2O3 — CID 46613463
3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propanamide (PubChem CID 46613463) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propanamide.
| Compound Name | 3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propanamide |
|---|---|
| PubChem CID | 46613463 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 3-(1,3-dioxo-2-azaspiro[4.5]decan-2-yl)propanamide |
| SMILES | NC(=O)CCN1C(=O)CC2(CCCCC2)C1=O |
| InChI | InChI=1S/C12H18N2O3/c13-9(15)4-7-14-10(16)8-12(11(14)17)5-2-1-3-6-12/h1-8H2,(H2,13,15) |
| InChIKey | MEJCCAIZPBSHQH-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|