C12H23N3O4 — CID 107838542
(2S)-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]-2-hydroxybutanoic acid (PubChem CID 107838542) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is (2S)-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107838542 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | (2S)-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]-2-hydroxybutanoic acid |
| SMILES | CN(C)C1CCN(C(=O)NCC[C@H](O)C(=O)O)CC1 |
| InChI | InChI=1S/C12H23N3O4/c1-14(2)9-4-7-15(8-5-9)12(19)13-6-3-10(16)11(17)18/h9-10,16H,3-8H2,1-2H3,(H,13,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | DNOYAKNKQNRUMI-JTQLQIEISA-N |
| XLogP | -0.44 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |