C12H24N4O3 — CID 67154382
(2S)-2-amino-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 67154382) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S)-2-amino-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67154382 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2S)-2-amino-4-[[4-(dimethylamino)piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | CN(C)C1CCN(C(=O)NCC[C@H](N)C(=O)O)CC1 |
| InChI | InChI=1S/C12H24N4O3/c1-15(2)9-4-7-16(8-5-9)12(19)14-6-3-10(13)11(17)18/h9-10H,3-8,13H2,1-2H3,(H,14,19)(H,17,18)/t10-/m0/s1 |
| InChIKey | QYLNYDWDSPIUFR-JTQLQIEISA-N |
| XLogP | -0.48 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |