C13H27N3O4 — CID 107839083
4-[[1-(dimethylamino)-4-methylpentan-2-yl]carbamoylamino]-2-hydroxybutanoic acid (PubChem CID 107839083) has the molecular formula C13H27N3O4 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[[1-(dimethylamino)-4-methylpentan-2-yl]carbamoylamino]-2-hydroxybutanoic acid.
| Compound Name | 4-[[1-(dimethylamino)-4-methylpentan-2-yl]carbamoylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107839083 |
| Molecular Formula | C13H27N3O4 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-[[1-(dimethylamino)-4-methylpentan-2-yl]carbamoylamino]-2-hydroxybutanoic acid |
| SMILES | CC(C)CC(CN(C)C)NC(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C13H27N3O4/c1-9(2)7-10(8-16(3)4)15-13(20)14-6-5-11(17)12(18)19/h9-11,17H,5-8H2,1-4H3,(H,18,19)(H2,14,15,20) |
| InChIKey | IHJPNOLEJGSJQU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |