C12H24N2O4 — CID 107840286
(2S)-2-hydroxy-4-(4-methylhexan-2-ylcarbamoylamino)butanoic acid (PubChem CID 107840286) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-(4-methylhexan-2-ylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-(4-methylhexan-2-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 107840286 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (2S)-2-hydroxy-4-(4-methylhexan-2-ylcarbamoylamino)butanoic acid |
| SMILES | CCC(C)CC(C)NC(=O)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H24N2O4/c1-4-8(2)7-9(3)14-12(18)13-6-5-10(15)11(16)17/h8-10,15H,4-7H2,1-3H3,(H,16,17)(H2,13,14,18)/t8?,9?,10-/m0/s1 |
| InChIKey | UWCQMLXMGABSAB-RTBKNWGFSA-N |
| XLogP | 0.95 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |