C12H20N2O6 — CID 107839207
(2R)-2-[[cyclopropyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid (PubChem CID 107839207) has the molecular formula C12H20N2O6 and a molecular weight of 288.30 g/mol. Its IUPAC name is (2R)-2-[[cyclopropyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[cyclopropyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107839207 |
| Molecular Formula | C12H20N2O6 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | (2R)-2-[[cyclopropyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)N(CCO)C1CC1)C(=O)O |
| InChI | InChI=1S/C12H20N2O6/c15-7-6-14(8-4-5-8)12(20)13-9(11(18)19)2-1-3-10(16)17/h8-9,15H,1-7H2,(H,13,20)(H,16,17)(H,18,19)/t9-/m1/s1 |
| InChIKey | CKJHKARNSYFCDO-SECBINFHSA-N |
| XLogP | -0.14 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |