C13H22N2O6 — CID 107841430
(2R)-2-[[cyclobutyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid (PubChem CID 107841430) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-2-[[cyclobutyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[cyclobutyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107841430 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2R)-2-[[cyclobutyl(2-hydroxyethyl)carbamoyl]amino]hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)N(CCO)C1CCC1)C(=O)O |
| InChI | InChI=1S/C13H22N2O6/c16-8-7-15(9-3-1-4-9)13(21)14-10(12(19)20)5-2-6-11(17)18/h9-10,16H,1-8H2,(H,14,21)(H,17,18)(H,19,20)/t10-/m1/s1 |
| InChIKey | QHZHAXWMMKRMMU-SNVBAGLBSA-N |
| XLogP | 0.25 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |