C11H17F3N2O4 — CID 107840299
(2S)-2-hydroxy-4-[[3-(trifluoromethyl)piperidine-1-carbonyl]amino]butanoic acid (PubChem CID 107840299) has the molecular formula C11H17F3N2O4 and a molecular weight of 298.26 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[[3-(trifluoromethyl)piperidine-1-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[[3-(trifluoromethyl)piperidine-1-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 107840299 |
| Molecular Formula | C11H17F3N2O4 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | (2S)-2-hydroxy-4-[[3-(trifluoromethyl)piperidine-1-carbonyl]amino]butanoic acid |
| SMILES | O=C(O)[C@@H](O)CCNC(=O)N1CCCC(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H17F3N2O4/c12-11(13,14)7-2-1-5-16(6-7)10(20)15-4-3-8(17)9(18)19/h7-8,17H,1-6H2,(H,15,20)(H,18,19)/t7?,8-/m0/s1 |
| InChIKey | WBMUYXJXJYBNPF-MQWKRIRWSA-N |
| XLogP | 0.81 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |