C10H17F3N2O4 — CID 107840664
(2S)-2-hydroxy-4-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid (PubChem CID 107840664) has the molecular formula C10H17F3N2O4 and a molecular weight of 286.25 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 107840664 |
| Molecular Formula | C10H17F3N2O4 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (2S)-2-hydroxy-4-(5,5,5-trifluoropentylcarbamoylamino)butanoic acid |
| SMILES | O=C(NCCCCC(F)(F)F)NCC[C@H](O)C(=O)O |
| InChI | InChI=1S/C10H17F3N2O4/c11-10(12,13)4-1-2-5-14-9(19)15-6-3-7(16)8(17)18/h7,16H,1-6H2,(H,17,18)(H2,14,15,19)/t7-/m0/s1 |
| InChIKey | XVLMFLIPUZGUIQ-ZETCQYMHSA-N |
| XLogP | 0.85 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|