C13H21N3O5 — CID 107840639
(2S)-2-hydroxy-4-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)amino]butanoic acid (PubChem CID 107840639) has the molecular formula C13H21N3O5 and a molecular weight of 299.33 g/mol. Its IUPAC name is (2S)-2-hydroxy-4-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)amino]butanoic acid.
| Compound Name | (2S)-2-hydroxy-4-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 107840639 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2S)-2-hydroxy-4-[(2-oxo-1,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carbonyl)amino]butanoic acid |
| SMILES | O=C1CCC2CN(C(=O)NCC[C@H](O)C(=O)O)CCC2N1 |
| InChI | InChI=1S/C13H21N3O5/c17-10(12(19)20)3-5-14-13(21)16-6-4-9-8(7-16)1-2-11(18)15-9/h8-10,17H,1-7H2,(H,14,21)(H,15,18)(H,19,20)/t8?,9?,10-/m0/s1 |
| InChIKey | WVMLCRFIKFUHPQ-RTBKNWGFSA-N |
| XLogP | -0.87 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |