C12H21N3O6 — CID 107840822
(2S)-2-hydroxy-3-[[3-(propan-2-ylcarbamoyl)morpholine-4-carbonyl]amino]propanoic acid (PubChem CID 107840822) has the molecular formula C12H21N3O6 and a molecular weight of 303.31 g/mol. Its IUPAC name is (2S)-2-hydroxy-3-[[3-(propan-2-ylcarbamoyl)morpholine-4-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-hydroxy-3-[[3-(propan-2-ylcarbamoyl)morpholine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 107840822 |
| Molecular Formula | C12H21N3O6 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (2S)-2-hydroxy-3-[[3-(propan-2-ylcarbamoyl)morpholine-4-carbonyl]amino]propanoic acid |
| SMILES | CC(C)NC(=O)C1COCCN1C(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C12H21N3O6/c1-7(2)14-10(17)8-6-21-4-3-15(8)12(20)13-5-9(16)11(18)19/h7-9,16H,3-6H2,1-2H3,(H,13,20)(H,14,17)(H,18,19)/t8?,9-/m0/s1 |
| InChIKey | ZZHOZRXAMYTNET-GKAPJAKFSA-N |
| XLogP | -1.63 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |