C7H14N4O5 — CID 107840831
(2S)-3-[2-(carbamoylamino)ethylcarbamoylamino]-2-hydroxypropanoic acid (PubChem CID 107840831) has the molecular formula C7H14N4O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is (2S)-3-[2-(carbamoylamino)ethylcarbamoylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[2-(carbamoylamino)ethylcarbamoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107840831 |
| Molecular Formula | C7H14N4O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (2S)-3-[2-(carbamoylamino)ethylcarbamoylamino]-2-hydroxypropanoic acid |
| SMILES | NC(=O)NCCNC(=O)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C7H14N4O5/c8-6(15)9-1-2-10-7(16)11-3-4(12)5(13)14/h4,12H,1-3H2,(H,13,14)(H3,8,9,15)(H2,10,11,16)/t4-/m0/s1 |
| InChIKey | HMIHLFGSBCOCFY-BYPYZUCNSA-N |
| XLogP | -2.60 |
| TPSA | 153.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|