C11H22N2O4 — CID 107841054
2-hydroxy-4-(2-methylpentan-2-ylcarbamoylamino)butanoic acid (PubChem CID 107841054) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-hydroxy-4-(2-methylpentan-2-ylcarbamoylamino)butanoic acid.
| Compound Name | 2-hydroxy-4-(2-methylpentan-2-ylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 107841054 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-hydroxy-4-(2-methylpentan-2-ylcarbamoylamino)butanoic acid |
| SMILES | CCCC(C)(C)NC(=O)NCCC(O)C(=O)O |
| InChI | InChI=1S/C11H22N2O4/c1-4-6-11(2,3)13-10(17)12-7-5-8(14)9(15)16/h8,14H,4-7H2,1-3H3,(H,15,16)(H2,12,13,17) |
| InChIKey | IFEVNMAWJCENAR-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |