C10H6BrN3O2 — CID 107841842
4-bromo-2-(2,5-dioxoimidazolidin-1-yl)benzonitrile (PubChem CID 107841842) has the molecular formula C10H6BrN3O2 and a molecular weight of 280.08 g/mol. Its IUPAC name is 4-bromo-2-(2,5-dioxoimidazolidin-1-yl)benzonitrile.
| Compound Name | 4-bromo-2-(2,5-dioxoimidazolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 107841842 |
| Molecular Formula | C10H6BrN3O2 |
| Molecular Weight | 280.08 g/mol |
| Exact Mass | 278.96 |
| IUPAC Name | 4-bromo-2-(2,5-dioxoimidazolidin-1-yl)benzonitrile |
| SMILES | N#Cc1ccc(Br)cc1N1C(=O)CNC1=O |
| InChI | InChI=1S/C10H6BrN3O2/c11-7-2-1-6(4-12)8(3-7)14-9(15)5-13-10(14)16/h1-3H,5H2,(H,13,16) |
| InChIKey | NVBUDYZCGOOLSB-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.08 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|