C13H20N2O5 — CID 107843413
3-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-ethoxybenzamide (PubChem CID 107843413) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-ethoxybenzamide.
| Compound Name | 3-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-ethoxybenzamide |
|---|---|
| PubChem CID | 107843413 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 3-amino-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-ethoxybenzamide |
| SMILES | CCOc1cc(N)cc(C(=O)NC(CO)(CO)CO)c1 |
| InChI | InChI=1S/C13H20N2O5/c1-2-20-11-4-9(3-10(14)5-11)12(19)15-13(6-16,7-17)8-18/h3-5,16-18H,2,6-8,14H2,1H3,(H,15,19) |
| InChIKey | QWTZOLPXLAOUIS-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|