C12H20N2O6S — CID 107843768
2-(4-aminophenoxy)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]ethanesulfonamide (PubChem CID 107843768) has the molecular formula C12H20N2O6S and a molecular weight of 320.37 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]ethanesulfonamide.
| Compound Name | 2-(4-aminophenoxy)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]ethanesulfonamide |
|---|---|
| PubChem CID | 107843768 |
| Molecular Formula | C12H20N2O6S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(4-aminophenoxy)-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]ethanesulfonamide |
| SMILES | Nc1ccc(OCCS(=O)(=O)NC(CO)(CO)CO)cc1 |
| InChI | InChI=1S/C12H20N2O6S/c13-10-1-3-11(4-2-10)20-5-6-21(18,19)14-12(7-15,8-16)9-17/h1-4,14-17H,5-9,13H2 |
| InChIKey | FLFZMSCKQIOIAR-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 142.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|