C15H26N2O3S — CID 65039925
2-(4-aminophenoxy)-N-(3-ethylpentan-3-yl)ethanesulfonamide (PubChem CID 65039925) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-(4-aminophenoxy)-N-(3-ethylpentan-3-yl)ethanesulfonamide.
| Compound Name | 2-(4-aminophenoxy)-N-(3-ethylpentan-3-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 65039925 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 2-(4-aminophenoxy)-N-(3-ethylpentan-3-yl)ethanesulfonamide |
| SMILES | CCC(CC)(CC)NS(=O)(=O)CCOc1ccc(N)cc1 |
| InChI | InChI=1S/C15H26N2O3S/c1-4-15(5-2,6-3)17-21(18,19)12-11-20-14-9-7-13(16)8-10-14/h7-10,17H,4-6,11-12,16H2,1-3H3 |
| InChIKey | HNGJFZVRZOQINM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|