C11H13ClN2O6 — CID 107845619
3-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-nitrobenzamide (PubChem CID 107845619) has the molecular formula C11H13ClN2O6 and a molecular weight of 304.69 g/mol. Its IUPAC name is 3-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-nitrobenzamide.
| Compound Name | 3-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 107845619 |
| Molecular Formula | C11H13ClN2O6 |
| Molecular Weight | 304.69 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 3-chloro-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]-5-nitrobenzamide |
| SMILES | O=C(NC(CO)(CO)CO)c1cc(Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H13ClN2O6/c12-8-1-7(2-9(3-8)14(19)20)10(18)13-11(4-15,5-16)6-17/h1-3,15-17H,4-6H2,(H,13,18) |
| InChIKey | GHGYCIUZWRFTAW-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 132.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.69 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|