C23H21ClN2O8 — CID 30449264
4-[3-(3-chlorophenoxy)-5-nitrophenoxy]-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide (PubChem CID 30449264) has the molecular formula C23H21ClN2O8 and a molecular weight of 488.88 g/mol. Its IUPAC name is 4-[3-(3-chlorophenoxy)-5-nitrophenoxy]-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide.
| Compound Name | 4-[3-(3-chlorophenoxy)-5-nitrophenoxy]-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 30449264 |
| Molecular Formula | C23H21ClN2O8 |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 4-[3-(3-chlorophenoxy)-5-nitrophenoxy]-N-[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]benzamide |
| SMILES | O=C(NC(CO)(CO)CO)c1ccc(Oc2cc(Oc3cccc(Cl)c3)cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C23H21ClN2O8/c24-16-2-1-3-19(8-16)34-21-10-17(26(31)32)9-20(11-21)33-18-6-4-15(5-7-18)22(30)25-23(12-27,13-28)14-29/h1-11,27-29H,12-14H2,(H,25,30) |
| InChIKey | YNHFYWKYPRLEQS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 151.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|