C13H22ClF2NO — CID 107847350
N-(6-chlorohexyl)-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 107847350) has the molecular formula C13H22ClF2NO and a molecular weight of 281.77 g/mol. Its IUPAC name is N-(6-chlorohexyl)-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(6-chlorohexyl)-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107847350 |
| Molecular Formula | C13H22ClF2NO |
| Molecular Weight | 281.77 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-(6-chlorohexyl)-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | O=C(NCCCCCCCl)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H22ClF2NO/c14-9-3-1-2-4-10-17-12(18)11-5-7-13(15,16)8-6-11/h11H,1-10H2,(H,17,18) |
| InChIKey | VXUHIHUIEKPLPM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|