C15H29NO — CID 107849599
6-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]hexan-1-ol (PubChem CID 107849599) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is 6-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]hexan-1-ol.
| Compound Name | 6-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 107849599 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | 6-[(3,5-dimethylcyclohex-3-en-1-yl)methylamino]hexan-1-ol |
| SMILES | CC1=CC(C)CC(CNCCCCCCO)C1 |
| InChI | InChI=1S/C15H29NO/c1-13-9-14(2)11-15(10-13)12-16-7-5-3-4-6-8-17/h9,13,15-17H,3-8,10-12H2,1-2H3 |
| InChIKey | INHTWHBLFBAFIS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|