C19H21N — CID 107849884
N-[(3-cyclopropylphenyl)methyl]-2,3-dihydro-1H-inden-2-amine (PubChem CID 107849884) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[(3-cyclopropylphenyl)methyl]-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-[(3-cyclopropylphenyl)methyl]-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 107849884 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | N-[(3-cyclopropylphenyl)methyl]-2,3-dihydro-1H-inden-2-amine |
| SMILES | c1cc(CNC2Cc3ccccc3C2)cc(C2CC2)c1 |
| InChI | InChI=1S/C19H21N/c1-2-6-18-12-19(11-17(18)5-1)20-13-14-4-3-7-16(10-14)15-8-9-15/h1-7,10,15,19-20H,8-9,11-13H2 |
| InChIKey | RFBOAGJAMRVAMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |