C17H25N — CID 79978765
N-[(3-cyclopropylphenyl)methyl]-3-methylcyclohexan-1-amine (PubChem CID 79978765) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is N-[(3-cyclopropylphenyl)methyl]-3-methylcyclohexan-1-amine.
| Compound Name | N-[(3-cyclopropylphenyl)methyl]-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 79978765 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | N-[(3-cyclopropylphenyl)methyl]-3-methylcyclohexan-1-amine |
| SMILES | CC1CCCC(NCc2cccc(C3CC3)c2)C1 |
| InChI | InChI=1S/C17H25N/c1-13-4-2-7-17(10-13)18-12-14-5-3-6-16(11-14)15-8-9-15/h3,5-6,11,13,15,17-18H,2,4,7-10,12H2,1H3 |
| InChIKey | POGLVGUWDJLMPL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |