About 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol
2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol (PubChem CID 107850476) has the molecular formula C9H17N3O3
and a molecular weight of 215.25 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol |
| PubChem CID | 107850476 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol |
| SMILES | Cc1[nH]cnc1CNC(CO)(CO)CO |
| InChI | InChI=1S/C9H17N3O3/c1-7-8(11-6-10-7)2-12-9(3-13,4-14)5-15/h6,12-15H,2-5H2,1H3,(H,10,11) |
| InChIKey | LMLLMBNVXOSIDS-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol?
The IUPAC name of 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol (CID 107850476) is 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol.
What is the SMILES notation for 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol?
The canonical SMILES for 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol is Cc1[nH]cnc1CNC(CO)(CO)CO.
What is the InChIKey of 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol?
The InChIKey is LMLLMBNVXOSIDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O3/c1-7-8(11-6-10-7)2-12-9(3-13,4-14)5-15/h6,12-15H,2-5H2,1H3,(H,10,11).
What are the key properties of 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol?
2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol has a molecular weight of 215.25 g/mol, XLogP of -1.48, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)-2-[(5-methyl-1H-imidazol-4-yl)methylamino]propane-1,3-diol is sourced from PubChem (CID 107850476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).