About 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile
4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile (PubChem CID 107852402) has the molecular formula C11H15N3O3
and a molecular weight of 237.26 g/mol. Its IUPAC name is 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile |
| PubChem CID | 107852402 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile |
| SMILES | N#Cc1cc(CNC(CO)(CO)CO)ccn1 |
| InChI | InChI=1S/C11H15N3O3/c12-4-10-3-9(1-2-13-10)5-14-11(6-15,7-16)8-17/h1-3,14-17H,5-8H2 |
| InChIKey | FPLOKLHCLGYEHN-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 109.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile?
The IUPAC name of 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile (CID 107852402) is 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile.
What is the SMILES notation for 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile?
The canonical SMILES for 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile is N#Cc1cc(CNC(CO)(CO)CO)ccn1.
What is the InChIKey of 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile?
The InChIKey is FPLOKLHCLGYEHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O3/c12-4-10-3-9(1-2-13-10)5-14-11(6-15,7-16)8-17/h1-3,14-17H,5-8H2.
What are the key properties of 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile?
4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile has a molecular weight of 237.26 g/mol, XLogP of -1.24, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[1,3-dihydroxy-2-(hydroxymethyl)propan-2-yl]amino]methyl]pyridine-2-carbonitrile is sourced from PubChem (CID 107852402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).