C8H7N3O2 — CID 126744334
(2-cyano-4-pyridinyl)methylcarbamic acid (PubChem CID 126744334) has the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. Its IUPAC name is (2-cyano-4-pyridinyl)methylcarbamic acid.
| Compound Name | (2-cyano-4-pyridinyl)methylcarbamic acid |
|---|---|
| PubChem CID | 126744334 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | (2-cyano-4-pyridinyl)methylcarbamic acid |
| SMILES | N#Cc1cc(CNC(=O)O)ccn1 |
| InChI | InChI=1S/C8H7N3O2/c9-4-7-3-6(1-2-10-7)5-11-8(12)13/h1-3,11H,5H2,(H,12,13) |
| InChIKey | XDJBHSKHUGNGHD-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |