C17H24N4O — CID 168892618
1-[(2-cyano-4-pyridinyl)methyl]-3-(2,4,4-trimethylcyclohexyl)urea (PubChem CID 168892618) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is 1-[(2-cyano-4-pyridinyl)methyl]-3-(2,4,4-trimethylcyclohexyl)urea.
| Compound Name | 1-[(2-cyano-4-pyridinyl)methyl]-3-(2,4,4-trimethylcyclohexyl)urea |
|---|---|
| PubChem CID | 168892618 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | 1-[(2-cyano-4-pyridinyl)methyl]-3-(2,4,4-trimethylcyclohexyl)urea |
| SMILES | CC1CC(C)(C)CCC1NC(=O)NCc1ccnc(C#N)c1 |
| InChI | InChI=1S/C17H24N4O/c1-12-9-17(2,3)6-4-15(12)21-16(22)20-11-13-5-7-19-14(8-13)10-18/h5,7-8,12,15H,4,6,9,11H2,1-3H3,(H2,20,21,22) |
| InChIKey | FAKKXDUSSWBCCC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |