C14H30N4O3S — CID 167803517
1-[2-(dimethylsulfamoylamino)ethyl]-3-(2,4,4-trimethylcyclohexyl)urea (PubChem CID 167803517) has the molecular formula C14H30N4O3S and a molecular weight of 334.49 g/mol. Its IUPAC name is 1-[2-(dimethylsulfamoylamino)ethyl]-3-(2,4,4-trimethylcyclohexyl)urea.
| Compound Name | 1-[2-(dimethylsulfamoylamino)ethyl]-3-(2,4,4-trimethylcyclohexyl)urea |
|---|---|
| PubChem CID | 167803517 |
| Molecular Formula | C14H30N4O3S |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 1-[2-(dimethylsulfamoylamino)ethyl]-3-(2,4,4-trimethylcyclohexyl)urea |
| SMILES | CC1CC(C)(C)CCC1NC(=O)NCCNS(=O)(=O)N(C)C |
| InChI | InChI=1S/C14H30N4O3S/c1-11-10-14(2,3)7-6-12(11)17-13(19)15-8-9-16-22(20,21)18(4)5/h11-12,16H,6-10H2,1-5H3,(H2,15,17,19) |
| InChIKey | FYKPWPQZMUOGNE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|