C16H13BrFN3 — CID 107853135
5-bromo-1-(2,3-dihydro-1H-inden-2-yl)-6-fluorobenzimidazol-2-amine (PubChem CID 107853135) has the molecular formula C16H13BrFN3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 5-bromo-1-(2,3-dihydro-1H-inden-2-yl)-6-fluorobenzimidazol-2-amine.
| Compound Name | 5-bromo-1-(2,3-dihydro-1H-inden-2-yl)-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 107853135 |
| Molecular Formula | C16H13BrFN3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 5-bromo-1-(2,3-dihydro-1H-inden-2-yl)-6-fluorobenzimidazol-2-amine |
| SMILES | Nc1nc2cc(Br)c(F)cc2n1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H13BrFN3/c17-12-7-14-15(8-13(12)18)21(16(19)20-14)11-5-9-3-1-2-4-10(9)6-11/h1-4,7-8,11H,5-6H2,(H2,19,20) |
| InChIKey | DQICLDONUMYPNO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |