C14H15BrFN3 — CID 66088063
1-(2-bicyclo[2.2.1]heptanyl)-5-bromo-6-fluorobenzimidazol-2-amine (PubChem CID 66088063) has the molecular formula C14H15BrFN3 and a molecular weight of 324.20 g/mol. Its IUPAC name is 1-(2-bicyclo[2.2.1]heptanyl)-5-bromo-6-fluorobenzimidazol-2-amine.
| Compound Name | 1-(2-bicyclo[2.2.1]heptanyl)-5-bromo-6-fluorobenzimidazol-2-amine |
|---|---|
| PubChem CID | 66088063 |
| Molecular Formula | C14H15BrFN3 |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | 1-(2-bicyclo[2.2.1]heptanyl)-5-bromo-6-fluorobenzimidazol-2-amine |
| SMILES | Nc1nc2cc(Br)c(F)cc2n1C1CC2CCC1C2 |
| InChI | InChI=1S/C14H15BrFN3/c15-9-5-11-13(6-10(9)16)19(14(17)18-11)12-4-7-1-2-8(12)3-7/h5-8,12H,1-4H2,(H2,17,18) |
| InChIKey | QLQAWJAJVZFVSK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |