C16H14ClN3 — CID 107853138
4-chloro-1-(2,3-dihydro-1H-inden-2-yl)benzimidazol-2-amine (PubChem CID 107853138) has the molecular formula C16H14ClN3 and a molecular weight of 283.76 g/mol. Its IUPAC name is 4-chloro-1-(2,3-dihydro-1H-inden-2-yl)benzimidazol-2-amine.
| Compound Name | 4-chloro-1-(2,3-dihydro-1H-inden-2-yl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 107853138 |
| Molecular Formula | C16H14ClN3 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 4-chloro-1-(2,3-dihydro-1H-inden-2-yl)benzimidazol-2-amine |
| SMILES | Nc1nc2c(Cl)cccc2n1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C16H14ClN3/c17-13-6-3-7-14-15(13)19-16(18)20(14)12-8-10-4-1-2-5-11(10)9-12/h1-7,12H,8-9H2,(H2,18,19) |
| InChIKey | JVITUWIOLNWVKP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |