C13H15N3 — CID 107854371
[3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]methanamine (PubChem CID 107854371) has the molecular formula C13H15N3 and a molecular weight of 213.28 g/mol. Its IUPAC name is [3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]methanamine.
| Compound Name | [3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]methanamine |
|---|---|
| PubChem CID | 107854371 |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | [3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]methanamine |
| SMILES | NCc1cncn1C1Cc2ccccc2C1 |
| InChI | InChI=1S/C13H15N3/c14-7-13-8-15-9-16(13)12-5-10-3-1-2-4-11(10)6-12/h1-4,8-9,12H,5-7,14H2 |
| InChIKey | GCVQOKSXEPWMOH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |