C17H21N3 — CID 107854524
4-[3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]piperidine (PubChem CID 107854524) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-[3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]piperidine.
| Compound Name | 4-[3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]piperidine |
|---|---|
| PubChem CID | 107854524 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-[3-(2,3-dihydro-1H-inden-2-yl)imidazol-4-yl]piperidine |
| SMILES | c1ccc2c(c1)CC(n1cncc1C1CCNCC1)C2 |
| InChI | InChI=1S/C17H21N3/c1-2-4-15-10-16(9-14(15)3-1)20-12-19-11-17(20)13-5-7-18-8-6-13/h1-4,11-13,16,18H,5-10H2 |
| InChIKey | YYYIQERTVQMTQU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |