C21H30N2O4 — CID 10785626
1',5-dimorpholin-4-yl-7,7'-spirobi[bicyclo[3.2.0]heptane]-6,6'-dione (PubChem CID 10785626) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1',5-dimorpholin-4-yl-7,7'-spirobi[bicyclo[3.2.0]heptane]-6,6'-dione.
| Compound Name | 1',5-dimorpholin-4-yl-7,7'-spirobi[bicyclo[3.2.0]heptane]-6,6'-dione |
|---|---|
| PubChem CID | 10785626 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1',5-dimorpholin-4-yl-7,7'-spirobi[bicyclo[3.2.0]heptane]-6,6'-dione |
| SMILES | O=C1C2CCCC2(N2CCOCC2)C12C(=O)C1(N3CCOCC3)CCCC12 |
| InChI | InChI=1S/C21H30N2O4/c24-17-15-3-1-6-20(15,23-9-13-27-14-10-23)21(17)16-4-2-5-19(16,18(21)25)22-7-11-26-12-8-22/h15-16H,1-14H2 |
| InChIKey | CHDDZISFZDXYQX-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|